CAS 15400-47-2

ethyl 2-(methylsulfanyl)-4-(phenylsulfanyl)pyrimidine-5-carboxylate

Description:

Ethyl 2-(methylsulfanyl)-4-(phenylsulfanyl)pyrimidine-5-carboxylate is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing nitrogen atoms. This compound features various functional groups, including an ethyl ester, a methylsulfanyl group, and a phenylsulfanyl group, contributing to its unique chemical properties. The presence of sulfur in the methylsulfanyl and phenylsulfanyl substituents can influence the compound's reactivity and solubility. Ethyl 2-(methylsulfanyl)-4-(phenylsulfanyl)pyrimidine-5-carboxylate may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure suggests potential interactions with biological targets, which could be explored in pharmacological studies. Additionally, the compound's synthesis and characterization would typically involve standard organic chemistry techniques, including nucleophilic substitutions and esterification reactions. Overall, this compound represents a class of heterocyclic compounds that may have applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₄H₁₄N₂O₂S₂

InChI: InChI=1/C14H14N2O2S2/c1-3-18-13(17)11-9-15-14(19-2)16-12(11)20-10-7-5-4-6-8-10/h4-9H,3H2,1-2H3

Synonyms:

• Ethyl 2-methylthio-4-phenylthiopyrimidine-5-carboxylate