CAS 15400-53-0
:2-Amino-5-carboethoxy-4-hydroxypyrimidine
Description:
2-Amino-5-carboethoxy-4-hydroxypyrimidine is a pyrimidine derivative characterized by the presence of an amino group, a hydroxyl group, and a carboethoxy substituent on the pyrimidine ring. This compound typically exhibits properties associated with both basic and acidic functional groups, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. The hydroxyl group contributes to its potential solubility in polar solvents, while the carboethoxy group can influence its reactivity and stability. Additionally, the presence of the amino group may impart basicity, enabling the compound to form salts with acids. This substance is of interest in medicinal chemistry and may have applications in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further research in drug development. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C7H9N3O3
InChI:InChI=1/C7H9N3O3/c1-2-13-6(12)4-3-9-7(8)10-5(4)11/h3H,2H2,1H3,(H3,8,9,10,11)
InChI key:InChIKey=HRRHGLKNOJHIGY-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(=O)NC(N)=NC1
Synonyms:- 2-Amino-4-hydroxy-5-pyrimidine carbonic acid ethyl ester
- 2-Amino-4-hydroxypyrimidine-5-carboxylic acid ethyl ester
- 2-Amino-5-ethoxycarbonyl-4-hydroxypyrimidine
- 5-Pyrimidinecarboxylic acid, 2-amino-1,4-dihydro-4-oxo-, ethyl ester
- 5-Pyrimidinecarboxylic acid, 2-amino-4-hydroxy-, ethyl ester
- Ethyl 2-Amino-6-Oxo-1,6-Dihydropyrimidine-5-Carboxylate
- Ethyl 2-amino-1,4-dihydro-4-oxo-5-pyrimidinecarboxylate
- Ethyl 2-amino-4-hydroxypyrimidine-5-carboxylate
- Ethyl2-amino-4-hydroxypyrimidine-5-carboxylate
- 2-Amino-5-ethoxycarbonyl-4-hydroxypyrimidine~2-Amino-4-hydroxypyrimidine-5-carboxylic acid ethyl ester~Ethyl 2-amino-4-hydroxypyrimidine-5-carboxylate
- ethyl 2-amino-1,4-dihydro-4-oxopyrimidine-5-carboxylate
- LABOTEST-BB LT00455352
- 2-Amino-4-hydroxy-5-pyrimidinecarboxylic acid ethyl ester
- 2-Amino-5-carbethoxyl-4-hydroxypyrimidine
- 2-Amino-1,4-dihydro-4-oxo-5-pyrimidinecarboxylic acid ethyl ester
- 2-AMINO-5-CARBOETHOXY-4-HYDROXYPYRIMIDINE
- 2-Amino-4-hydroxypyrimidine-5-carboxylicacidethylester
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl 2-amino-4-hydroxypyrimidine-5-carboxylate, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H9N3O3Purity:95%Color and Shape:White to cream to pale yellow, Crystals or powder or crystalline powder or lumps or fused solidMolecular weight:183.17Ethyl 2-Amino-4-hydroxypyrimidine-5-carboxylate
CAS:Formula:C7H9N3O3Purity:95%Color and Shape:SolidMolecular weight:183.1647Ethyl 2-amino-4-hydroxypyrimidine-5-carboxylate
CAS:Ethyl 2-amino-4-hydroxypyrimidine-5-carboxylatePurity:95%Molecular weight:183.16g/molEthyl 2-Amino-4-hydroxypyrimidine-5-carboxylate
CAS:Formula:C7H9N3O3Purity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:183.17Ethyl 2-amino-4-hydroxypyrimidine-5-carboxylate
CAS:Formula:C7H9N3O3Purity:95%Color and Shape:SolidMolecular weight:183.167




