CAS 154016-57-6
:3-BROMO-5-(N-BOC)AMINOMETHYLISOXAZOLE
Description:
3-Bromo-5-(N-Boc)aminomethylisoxazole is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a bromine atom at the 3-position and a Boc (tert-butyloxycarbonyl) protected amine at the 5-position contributes to its reactivity and stability. The Boc group serves as a protective moiety for the amine, allowing for selective reactions without interfering with the amine functionality. This compound is often utilized in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of the isoxazole moiety may impart specific pharmacological properties, making it a subject of interest in drug discovery. As with many brominated compounds, it may exhibit unique reactivity patterns, making it valuable in synthetic applications. Proper handling and storage are essential due to its potential biological activity and the presence of bromine, which can be hazardous.
Formula:C9H13BrN2O3
InChI:InChI=1/C9H13BrN2O3/c1-9(2,3)14-8(13)11-5-6-4-7(10)12-15-6/h4H,5H2,1-3H3,(H,11,13)
SMILES:CC(C)(C)OC(=NCc1cc(Br)no1)O
Synonyms:- (3-Bromoisoxazol-5-Ylmethyl)Carbamic Acid Tert-Butyl Ester
- Carbamic acid, [(3-methyl-5-isoxazolyl)methyl]-, 1,1-dimethylethyl ester (9CI)
- (3-Bromoisoxazol-5-Ylmethyl)Carbamic Acid Tert-Butyl Ester, 95+%
- Tert-Butyl [(3-Bromoisoxazol-5-Yl)Methyl]Carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
