CAS 15410-49-8
:2,3,4,5-tetra-O-acetyl-1,6-dibromo-1,6-dideoxyhexitol
Description:
2,3,4,5-tetra-O-acetyl-1,6-dibromo-1,6-dideoxyhexitol is a chemical compound characterized by its complex structure, which includes multiple acetyl groups and bromine substituents. This compound belongs to the class of sugar alcohols and is derived from hexitol, a six-carbon sugar alcohol. The presence of four acetyl groups indicates that it has been modified to enhance its solubility and stability, making it useful in various chemical reactions and applications. The dibromo substitution suggests that it may exhibit unique reactivity patterns, particularly in nucleophilic substitution reactions. Its dideoxy nature implies that it lacks hydroxyl groups at specific positions, which can influence its biological activity and interaction with enzymes. This compound is typically used in synthetic organic chemistry, particularly in the synthesis of more complex molecules or as an intermediate in the preparation of other chemical entities. As with many brominated compounds, it may also exhibit specific properties related to its halogen content, such as increased reactivity or changes in physical properties like melting and boiling points.
Formula:C14H20Br2O8
InChI:InChI=1/C14H20Br2O8/c1-7(17)21-11(5-15)13(23-9(3)19)14(24-10(4)20)12(6-16)22-8(2)18/h11-14H,5-6H2,1-4H3
SMILES:CC(=O)OC(CBr)C(C(C(CBr)OC(=O)C)OC(=O)C)OC(=O)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,3,4,5-Tetra-O-acetyl-1,6-dibromo-1,6-dideoxy-D-mannitol
CAS:2,3,4,5-Tetra-O-acetyl-1,6-dibromo-1,6-dideoxy-D-mannitol is a methylated oligosaccharide obtained by the chemical modification of mannitol. This product has a CAS number of 15410-49-8 and can be used as a saccharide in pharmaceuticals. It is also used as a reagent in the synthesis of polysaccharides. This product is also known to have high purity and can be modified to suit specific needs. 2,3,4,5-Tetra-O-acetyl-1,6-dibromo-1,6-dideoxy--D--mannitol may be useful for the treatment of diabetes mellitus type 2 and hyperglycemia.Formula:C14H20Br2O8Purity:Min. 95%Molecular weight:476.11 g/mol
