CAS 15411-54-8

1,4-Benzenedicarboximidamide

Description:

1,4-Benzenedicarboximidamide, also known as benzene-1,4-dicarboximidamide, is an organic compound characterized by the presence of two carboximidamide functional groups attached to a benzene ring at the 1 and 4 positions. This compound typically appears as a white to off-white solid and is soluble in polar solvents. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the carboximidamide groups imparts unique reactivity, making it a candidate for further chemical modifications. Additionally, the compound may exhibit interesting biological activities, although specific biological properties would require further investigation. Its CAS number, 15411-54-8, allows for easy identification and retrieval of information in chemical databases. As with many organic compounds, handling should be done with care, considering safety data sheets for proper guidelines on toxicity and reactivity. Overall, 1,4-Benzenedicarboximidamide is a versatile compound with potential utility in synthetic chemistry and related applications.

Formula: C₈H₁₀N₄

InChI: InChI=1S/C8H10N4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4H,(H3,9,10)(H3,11,12)

InChI key: InChIKey=UNMMLGAPDZGRJJ-UHFFFAOYSA-N

SMILES: C(=N)(N)C1=CC=C(C(=N)N)C=C1

Synonyms:

• 1,4-Benzenedicarboximidamide
• 4-Carbamimidoylbenzamide
• Terephthalamidine
• 1,4-Diamidinobenzene

1,4-Benzenedicarboximidamide

CAS: 15411-54-8

Formula: C₈H₁₀N₄

Purity: 97%

Molecular weight: 162.1918

Ref: IN-DA007XRQ

1,4-Diamidinobenzene

CAS: 15411-54-8

1,4-Diamidinobenzene is a chemical compound that belongs to the group of triazines. It has been extensively used in pharmaceutical preparations because of its stability and low toxicity. 1,4-Diamidinobenzene is an acid complex with a molecule that has a crystalline structure. It is soluble in organic solvents such as ethanol and acetone. The terminal half-life of 1,4-diamidinobenzene depends on the type of coating applied to the metal surface; it can be degradable or not. The electronic interaction between 1,4-diamidinobenzene and urokinase-type plasminogen increases its activity by tenfold when compared to other non-interacting molecules.

Formula: C₈H₁₀N₄

Purity: Min. 95%

Molecular weight: 162.19 g/mol

Ref: 3D-QAA41154

Terephthalamidine

CAS: 15411-54-8

Terephthalamidine, a phthalanilide derivative, bind DNA's minor groove and forms ionic complexes with biomolecules.

Formula: C₈H₁₀N₄

Color and Shape: Solid

Molecular weight: 162.19

Ref: TM-T34807