CAS 154130-99-1
:1,2,3,6-Tetrahydro-5-[3-(4-methylphenyl)-5-isoxazolyl]-1-propylpyridine
Description:
1,2,3,6-Tetrahydro-5-[3-(4-methylphenyl)-5-isoxazolyl]-1-propylpyridine, with CAS number 154130-99-1, is a chemical compound characterized by its complex structure, which includes a pyridine ring fused with a tetrahydro moiety and a substituent isoxazole ring. This compound typically exhibits properties associated with both heterocyclic and aromatic systems, contributing to its potential biological activity. It is often studied for its pharmacological properties, particularly in the context of neuropharmacology, due to its structural similarity to various neurotransmitter modulators. The presence of the isoxazole and the aromatic methylphenyl group may influence its solubility, stability, and interaction with biological targets. Additionally, the compound's stereochemistry can play a significant role in its activity and efficacy. As with many organic compounds, its reactivity and stability can be affected by environmental conditions such as pH and temperature. Overall, this compound represents a class of molecules that may have therapeutic potential, warranting further investigation in medicinal chemistry.
Formula:C18H22N2O
InChI:InChI=1S/C18H22N2O/c1-3-10-20-11-4-5-16(13-20)18-12-17(19-21-18)15-8-6-14(2)7-9-15/h5-9,12H,3-4,10-11,13H2,1-2H3
InChI key:InChIKey=FOQRKFCLRMMKAT-UHFFFAOYSA-N
SMILES:C(CC)N1CC(C2=CC(=NO2)C3=CC=C(C)C=C3)=CCC1
Synonyms:- 1,2,3,6-Tetrahydro-5-[3-(4-methylphenyl)-5-isoxazolyl]-1-propylpyridine
- Pd 144418
- Pyridine, 1,2,3,6-tetrahydro-5-[3-(4-methylphenyl)-5-isoxazolyl]-1-propyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
PD 144418-d7 Oxalate
CAS:Controlled ProductFormula:C18D7H15N2O·C2H2O4Color and Shape:NeatMolecular weight:379.458PD 144418 oxalate
CAS:PD 144418 oxalate is a cationic polymer that binds to the human protein receptor, which is involved in cancer. It has been shown to inhibit the activity of this protein and decrease the proliferation of cancer cells. PD 144418 oxalate also inhibits dopamine-induced locomotor activity and increases light emission from cationic polymers. This drug has potential clinical applications for the treatment of cancer, Parkinson's disease, and other disorders. PD 144418 oxalate is a synthetic compound that contains an hydroxyl group on one side of its chemical structure and a hydrogen bond on the other side.Formula:C18H22N2OPurity:Min. 95%Molecular weight:282.38 g/molPD 144418
CAS:PD 144418 displays potential antipsychotic activity.Formula:C18H22N2OPurity:98%Color and Shape:SolidMolecular weight:282.38


