CAS 154148-70-6
:5-Amino-2-piperidinone
Description:
5-Amino-2-piperidinone is an organic compound characterized by its piperidinone structure, which includes a six-membered ring containing one nitrogen atom and a carbonyl group. This compound features an amino group (-NH2) at the 5-position of the piperidinone ring, contributing to its basicity and potential reactivity. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the amino group. The compound is of interest in medicinal chemistry and pharmaceutical research due to its potential applications in drug development, particularly as a building block for synthesizing various bioactive molecules. Its reactivity can be attributed to the presence of both the amino and carbonyl functional groups, allowing for various chemical transformations. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C5H10N2O
InChI:InChI=1S/C5H10N2O/c6-4-1-2-5(8)7-3-4/h4H,1-3,6H2,(H,7,8)
InChI key:InChIKey=APDCFRUAEFSNPV-UHFFFAOYSA-N
SMILES:NC1CCC(=O)NC1
Synonyms:- 5-Aminopiperidin-2-one
- 2-Piperidinone, 5-amino-
- 5-Amino-2-piperidinone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Amino-piperidin-2-one hydrochloride
CAS:5-Amino-piperidin-2-one hydrochloride is an enantiomerically pure chiral molecule. It is a white solid with a molecular weight of 138.12 that has been shown to exhibit anti-inflammatory properties in experiments conducted on mice. This drug also has the ability to inhibit the enzyme cyclooxygenase, which plays an important role in the production of prostaglandins. 5-Amino-piperidin-2-one hydrochloride binds to the active site of cyclooxygenase and prevents its conversion of arachadonic acid into prostaglandins. 5-Amino-piperidin-2-one hydrochloride has been shown to be effective against many bacteria, including methicillin resistant Staphylococcus aureus (MRSA) and Mycobacterium tuberculosis, but not against Mycobacterium avium complex.Formula:C5H11ClN2OPurity:Min. 95%Molecular weight:150.61 g/mol5-Aminopiperidin-2-one
CAS:Controlled ProductFormula:C5H10N2OColor and Shape:NeatMolecular weight:114.146



