CAS 1542-34-3

3,5-Difluoro-4-iodoaniline

Description:

3,5-Difluoro-4-iodoaniline is an organic compound characterized by the presence of both fluorine and iodine substituents on an aniline backbone. It features two fluorine atoms located at the 3 and 5 positions and an iodine atom at the 4 position of the aromatic ring, which significantly influences its chemical properties. This compound is typically a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to the reactivity of the halogen substituents. The presence of the amino group (-NH2) makes it a basic compound, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the fluorine atoms can enhance the compound's lipophilicity and stability, while the iodine atom can serve as a leaving group in certain reactions. Overall, 3,5-Difluoro-4-iodoaniline is a valuable compound in synthetic organic chemistry, particularly in the development of new materials and biologically active molecules.

Formula: C₆H₄F₂IN

InChI: InChI=1/C6H4F2IN/c7-4-1-3(10)2-5(8)6(4)9/h1-2H,10H2

SMILES: c1c(cc(c(c1F)I)F)N

Synonyms:

• Buttpark 120\07-59
• 3,5-Difluoro-4-iodoaniline 97%
• 3,5-Difluoro-4-iodoaniline97%

3,5-Difluoro-4-iodoaniline

CAS: 1542-34-3

Formula: C₆H₄F₂IN

Purity: 96%

Color and Shape: Solid

Molecular weight: 255.0039

Ref: IN-DA007GBD

3,5-Difluoro-4-iodoaniline

CAS: 1542-34-3

3,5-Difluoro-4-iodoaniline

Formula: C₆H₄F₂IN

Purity: 98%

Color and Shape: Off White-Amber Solid

Molecular weight: 255.00g/mol

Ref: 54-PC2906

3,5-Difluoro-4-iodoaniline

CAS: 1542-34-3

Formula: C₆H₄F₂IN

Purity: 96%

Color and Shape: Solid

Molecular weight: 255.006

Ref: 10-F033298