CAS 1542-44-5
:2-chloro-N-(2-chloroethyl)-N-(3-fluorobenzyl)ethanamine
Description:
2-Chloro-N-(2-chloroethyl)-N-(3-fluorobenzyl)ethanamine, with the CAS number 1542-44-5, is a chemical compound that belongs to the class of amines. It features a chloroethyl group and a fluorobenzyl substituent, which contribute to its unique chemical properties. The presence of chlorine and fluorine atoms in its structure suggests that it may exhibit interesting reactivity and potential biological activity. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure indicates that it may engage in hydrogen bonding due to the amine functional group, which can influence its solubility in various solvents. Additionally, the presence of halogens may enhance its lipophilicity, affecting its interaction with biological systems. Due to its specific functional groups, this compound may be of interest in medicinal chemistry and drug development, particularly in the synthesis of pharmaceuticals or agrochemicals. However, safety and handling precautions should be observed, as halogenated compounds can pose health risks.
Formula:C11H14Cl2FN
InChI:InChI=1/C11H14Cl2FN/c12-4-6-15(7-5-13)9-10-2-1-3-11(14)8-10/h1-3,8H,4-7,9H2
SMILES:c1cc(cc(c1)F)CN(CCCl)CCCl
Synonyms:- benzenemethanamine, N,N-bis(2-chloroethyl)-3-fluoro-
- 2-Chloro-N-(2-chloroethyl)-N-(3-fluorobenzyl)ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
m-Fluoro-DCBA
CAS:<p>m-Fluoro-DCBA is a bioactive chemical</p>Formula:C11H14Cl2FNColor and Shape:SolidMolecular weight:250.14
