CAS 15422-20-5

1-(3,4-dichlorophenoxy)propan-2-one

Description:

1-(3,4-Dichlorophenoxy)propan-2-one, with the CAS number 15422-20-5, is an organic compound characterized by its structure, which features a propan-2-one backbone substituted with a 3,4-dichlorophenoxy group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in various fields, including agrochemicals and pharmaceuticals, due to its biological activity. The presence of the dichlorophenoxy moiety enhances its reactivity and interaction with biological systems. The compound is likely to exhibit moderate to low solubility in water, while being more soluble in organic solvents. Its chemical properties include the ability to undergo typical organic reactions such as nucleophilic substitutions and electrophilic aromatic substitutions. Safety data sheets should be consulted for handling and storage guidelines, as it may pose health risks if inhaled or ingested. Overall, 1-(3,4-dichlorophenoxy)propan-2-one is a compound of interest for its chemical properties and potential applications.

Formula: C₉H₈Cl₂O₂

InChI: InChI=1/C9H8Cl2O2/c1-6(12)5-13-7-2-3-8(10)9(11)4-7/h2-4H,5H2,1H3

SMILES: CC(=O)COc1ccc(c(c1)Cl)Cl

1-(3,4-Dichlorophenoxy)propan-2-one

CAS: 15422-20-5

Versatile small molecule scaffold

Formula: C₉H₈Cl₂O₂

Purity: Min. 95%

Molecular weight: 219.06 g/mol

Ref: 3D-QAA42220