
CAS 154221-27-9
:IMIBENCONAZOLE-DEBENZYL
Description:
Imibenconazole-debenzyl, identified by its CAS number 154221-27-9, is a chemical compound primarily used as a fungicide in agricultural applications. It belongs to the class of benzimidazole derivatives, which are known for their broad-spectrum antifungal properties. The compound exhibits characteristics typical of fungicides, including the ability to inhibit fungal cell division and growth by disrupting microtubule formation. Imibenconazole-debenzyl is often utilized to protect crops from various fungal pathogens, enhancing agricultural productivity. Its chemical structure includes a benzimidazole core, which contributes to its biological activity. The compound is generally characterized by moderate to low solubility in water, which can influence its application methods and environmental behavior. Additionally, it may possess specific toxicity profiles that necessitate careful handling and application to minimize risks to non-target organisms and the environment. As with many agrochemicals, regulatory assessments are essential to ensure safe usage in agricultural practices.
Formula:C10H8Cl2N4O
InChI:InChI=1S/C10H8Cl2N4O/c11-7-1-2-9(8(12)3-7)15-10(17)4-16-5-13-14-6-16/h1-3,5-6H,4H2,(H,15,17)
InChI key:SUABSSUUOLEOOZ-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1Cl)Cl)NC(=O)CN2C=NN=C2
Synonyms:- Imibenconazole-Debenzyl Standard
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Imibenconazole-desbenzyl-oxon
CAS:Controlled ProductFormula:C10H8Cl2N4OColor and Shape:NeatMolecular weight:271.1


