CAS 154229-19-3: Abiraterone
Description:Abiraterone is a synthetic organic compound primarily used in the treatment of prostate cancer. It functions as a selective inhibitor of the enzyme CYP17A1, which is crucial in the biosynthesis of androgens, including testosterone. By inhibiting this enzyme, Abiraterone effectively reduces androgen levels, thereby slowing the growth of androgen-dependent tumors. The compound is typically administered in the form of its acetate salt, Abiraterone acetate, which is more soluble and bioavailable. Abiraterone is characterized by its molecular formula, which reflects its complex structure, and it exhibits a moderate to high lipophilicity, allowing it to penetrate cellular membranes effectively. The drug is often used in combination with corticosteroids to mitigate potential side effects related to adrenal insufficiency. Common side effects include fatigue, hypertension, and electrolyte imbalances. Overall, Abiraterone represents a significant advancement in targeted cancer therapy, particularly for patients with metastatic castration-resistant prostate cancer.
Formula:C24H31NO
InChI:InChI=1S/C24H31NO/c1-23-11-9-18(26)14-17(23)5-6-19-21-8-7-20(16-4-3-13-25-15-16)24(21,2)12-10-22(19)23/h3-5,7,13,15,18-19,21-22,26H,6,8-12,14H2,1-2H3/t18-,19-,21-,22-,23-,24+/m0/s1
InChI key:InChIKey=GZOSMCIZMLWJML-VJLLXTKPSA-N
SMILES:OC1CC2=CCC3C4CC=C(C=5C=NC=CC5)C4(C)CCC3C2(C)CC1
- Synonyms:
- (3Beta)-17-(Pyridin-3-Yl)Androsta-5,16-Dien-3-Ol
- (3b)-17-(3-pyridinyl)-Androsta-5,16-dien-3-ol
- 17-(3-Pyridinyl)-androsta-5,16-dien-3β-ol
- 17-(3-Pyridyl)androsta-5,16-dien-3beta-ol
- Androsta-5,16-dien-3-ol, 17-(3-pyridinyl)-, (3β)-
- Cb 7598
- Abiraterone
