CAS 154230-29-2: TRANS-2-(4-CHLOROPHENYL)VINYLBORONIC ACID
Description:Trans-2-(4-chlorophenyl)vinylboronic acid is an organoboron compound characterized by the presence of a vinyl group and a boronic acid functional group. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. The presence of the boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki-Miyaura cross-coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The chlorophenyl group contributes to its electronic properties, potentially enhancing its reactivity and selectivity in coupling reactions. Additionally, the trans configuration of the vinyl group is significant, as it influences the compound's steric and electronic characteristics. This compound is often utilized in the development of pharmaceuticals and agrochemicals due to its ability to form stable complexes with various substrates. Safety data should be consulted for handling, as boronic acids can be sensitive to moisture and may require specific storage conditions.
Formula:C8H8BClO2
InChI:InChI=1/C8H8BClO2/c10-8-3-1-7(2-4-8)5-6-9(11)12/h1-6,11-12H/b6-5+
- Synonyms:
- Rarechem Al Ba 0169
- Trans-2-(4-Chlorophenyl)Vinylboronic Aci
- Trans-2-(4-Chlorphenyl)Vinylboronic Acid
- [(E)-2-(4-chlorophenyl)ethenyl]boronic acid
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | (4-Chlorostyryl)boronic acid REF: IN-DA003BVHCAS: 154230-29-2 | 96% | To inquire | Mon 07 Apr 25 |
 | trans-2-(4-Chlorophenyl)vinylboronic acid REF: 54-OR360040CAS: 154230-29-2 | 96% | 32.00 €~1,622.00 € | Tue 08 Apr 25 |
 | trans-2-(4-chlorophenyl)vinylboronic acid, 97% REF: AC-43134CAS: 154230-29-2 | 97% | To inquire | Tue 08 Apr 25 |
 | (4-Chlorostyryl)boronic acid REF: 10-F217422CAS: 154230-29-2 | 95.0% | - - - | Discontinued product |
 | trans-2-(4-Chlorophenyl)vinylboronic acid REF: 3D-FC40159CAS: 154230-29-2 | Min. 95% | - - - | Discontinued product |
(4-Chlorostyryl)boronic acid
Ref: IN-DA003BVH
| 1g | 116.00 € | ||
| 5g | 334.00 € | ||
| 100mg | 28.00 € | ||
| 250mg | 50.00 € |
Ref: 54-OR360040
| 1g | 95.00 € | ||
| 5g | 414.00 € | ||
| 25g | 1,622.00 € | ||
| 100mg | 32.00 € | ||
| 250mg | 36.00 € |
trans-2-(4-chlorophenyl)vinylboronic acid, 97%
Ref: AC-43134
| 1g | To inquire | ||
| 10g | To inquire |
(4-Chlorostyryl)boronic acid
Ref: 10-F217422
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information |
trans-2-(4-Chlorophenyl)vinylboronic acid
Ref: 3D-FC40159
| 25mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
