CymitQuimica logo

CAS 154258-42-1

:

3-(Dimethylamino)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-propen-1-one

Description:
3-(Dimethylamino)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-propen-1-one, with CAS number 154258-42-1, is an organic compound characterized by its unique structural features. It contains a dimethylamino group, which contributes to its basicity and potential reactivity, particularly in nucleophilic substitution reactions. The presence of a 3-fluoro-5-(trifluoromethyl)phenyl moiety enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The compound features a conjugated system due to the propenone structure, which can exhibit significant electronic properties, such as UV-Vis absorbance and potential for resonance stabilization. Additionally, the trifluoromethyl group is known for its electron-withdrawing effects, which can affect the compound's reactivity and interaction with other molecules. Overall, this compound's unique combination of functional groups and structural characteristics makes it a subject of interest for various applications, including pharmaceuticals and agrochemicals, where its electronic properties and reactivity can be exploited.
Formula:C12H11F4NO
InChI:InChI=1S/C12H11F4NO/c1-17(2)4-3-11(18)8-5-9(12(14,15)16)7-10(13)6-8/h3-7H,1-2H3
InChI key:InChIKey=MCOKEDWZWYSAKF-UHFFFAOYSA-N
SMILES:C(C=CN(C)C)(=O)C1=CC(C(F)(F)F)=CC(F)=C1
Synonyms:
  • 3-(Dimethylamino)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-2-propen-1-one
  • 2-Propen-1-one, 3-(dimethylamino)-1-[3-fluoro-5-(trifluoromethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.