CAS 154264-95-6

7-bromo-4-methyl-3,4-dihydro-2H-1,4-benzoxazine

Description:

7-Bromo-4-methyl-3,4-dihydro-2H-1,4-benzoxazine is a chemical compound characterized by its unique bicyclic structure, which includes a benzene ring fused to a heterocyclic oxazine moiety. This compound features a bromine atom and a methyl group as substituents, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the bromine atom enhances its electrophilic properties, making it a useful intermediate in various chemical reactions. The dihydro form indicates that the compound has two hydrogen atoms added to the oxazine ring, which can influence its stability and reactivity. Additionally, the compound may exhibit interesting biological activities, making it a candidate for further research in pharmacology. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 7-bromo-4-methyl-3,4-dihydro-2H-1,4-benzoxazine represents a versatile structure in the realm of organic chemistry.

Formula: C₉H₁₀BrNO

InChI: InChI=1/C9H10BrNO/c1-11-4-5-12-9-6-7(10)2-3-8(9)11/h2-3,6H,4-5H2,1H3

SMILES: CN1CCOc2cc(ccc12)Br

Synonyms:

• 7-Bromo-4-Methyl-2,3-Dihydro-1,4-Benzoxazine

7-bromo-4-methyl-3,4-dihydro-2H-1,4-benzoxazine

CAS: 154264-95-6

Formula: C₉H₁₀BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 228.0858

Ref: IN-DA00APJI

7-Bromo-3,4-dihydro-4-methyl-2H-1,4-benzoxazine

CAS: 154264-95-6

7-Bromo-3,4-dihydro-4-methyl-2H-1,4-benzoxazine

Formula: C₉H₁₀BrNO

Purity: ≥95%

Color and Shape: pale yellow low melting solid

Molecular weight: 228.09g/mol

Ref: 54-OR23220

7-Bromo-4-methyl-3,4-dihydro-2H-1,4-benzoxazine

CAS: 154264-95-6

Formula: C₉H₁₀BrNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 228.089

Ref: 10-F067521