CAS 15427-81-3
:2-amino-2,2-diphenylacetamide
Description:
2-Amino-2,2-diphenylacetamide, with the CAS number 15427-81-3, is an organic compound characterized by its amide functional group and two phenyl groups attached to a central carbon atom. This compound typically appears as a white to off-white solid and is known for its relatively low solubility in water, while being more soluble in organic solvents. It possesses a basic amino group, which can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. The presence of the diphenyl substituents contributes to its hydrophobic character, affecting its biological activity and potential applications in pharmaceuticals or as a chemical intermediate. Additionally, 2-amino-2,2-diphenylacetamide may exhibit various biological activities, making it of interest in medicinal chemistry. Its stability under standard conditions and the ability to form derivatives through chemical modifications further enhance its utility in research and industrial applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C14H14N2O
InChI:InChI=1/C14H14N2O/c15-13(17)14(16,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,16H2,(H2,15,17)
SMILES:c1ccc(cc1)C(c1ccccc1)(C(=N)O)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
