CAS 154314-62-2

4-Amino-2,6-difluorobenzoic acid

Description:

4-Amino-2,6-difluorobenzoic acid is an aromatic compound characterized by the presence of an amino group and two fluorine atoms attached to a benzoic acid structure. Its molecular formula is C7H6F2N O2, indicating that it contains seven carbon atoms, six hydrogen atoms, two fluorine atoms, one nitrogen atom, and two oxygen atoms. This compound typically appears as a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid group. The amino group contributes to its basicity, while the fluorine atoms enhance its reactivity and influence its electronic properties. 4-Amino-2,6-difluorobenzoic acid is often used in pharmaceutical research and development, particularly in the synthesis of various biologically active compounds. Its unique structure allows for potential applications in medicinal chemistry, where modifications can lead to new therapeutic agents. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₇H₅F₂NO₂

InChI: InChI=1S/C7H5F2NO2/c8-4-1-3(10)2-5(9)6(4)7(11)12/h1-2H,10H2,(H,11,12)

InChI key: InChIKey=RZYUIHNYUYKPOQ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(F)C=C(N)C=C1F

Synonyms:

• Benzoic acid, 4-amino-2,6-difluoro-
• 4-Amino-2,6-difluorobenzoic acid

4-Amino-2,6-difluorobenzoic acid

CAS: 154314-62-2

Formula: C₇H₅F₂NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 173.1169

Ref: IN-DA0039P9

4-Amino-2,6-difluorobenzoic acid

CAS: 154314-62-2

4-Amino-2,6-difluorobenzoic acid

Purity: 95%

Molecular weight: 173.12g/mol

Ref: 54-PC1002548

4-AMINO-2,6-DIFLUORO- BENZOIC ACID

CAS: 154314-62-2

Formula: C₇H₅F₂NO₂

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 173.119

Ref: 10-F513675

4-amino-2,6-difluorobenzoic acid

CAS: 154314-62-2

4-Amino-2,6-difluorobenzoic acid is a compound that is used in the preparation of amides. It reacts with ammonia to form an amide and hydrogen fluoride. The reaction mixture can be acidified with hydrochloric acid or acetic acid to produce the desired amide. 4-Amino-2,6-difluorobenzoic acid can also be used for decarboxylating carboxylic acids to produce amides.

Formula: C₇H₅NO₂F₂

Purity: Min. 95%

Molecular weight: 173.11 g/mol

Ref: 3D-EGA31462