CAS 154343-51-8
:2-chloro-5,8-dimethoxyquinoline-3-carbaldehyde
Description:
2-Chloro-5,8-dimethoxyquinoline-3-carbaldehyde is a chemical compound characterized by its quinoline structure, which features a chlorine atom and two methoxy groups attached to the aromatic ring. The presence of the aldehyde functional group at the 3-position contributes to its reactivity, making it useful in various synthetic applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent properties. Its molecular structure suggests potential biological activity, which has led to interest in its use in medicinal chemistry and as a building block in organic synthesis. The chlorine substituent can influence the compound's electronic properties and reactivity, while the methoxy groups can enhance solubility and stability. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, 2-chloro-5,8-dimethoxyquinoline-3-carbaldehyde is a versatile compound with applications in research and development within the field of organic chemistry.
Formula:C12H10ClNO3
InChI:InChI=1/C12H10ClNO3/c1-16-9-3-4-10(17-2)11-8(9)5-7(6-15)12(13)14-11/h3-6H,1-2H3
SMILES:COc1ccc(c2c1cc(C=O)c(Cl)n2)OC
Synonyms:- 3-Quinolinecarboxaldehyde, 2-Chloro-5,8-Dimethoxy-
- 2-Chloro-5,8-dimethoxyquinoline-3-carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-chloro-5,8-dimethoxy-3-quinolinecarbaldehyde
CAS:Formula:C12H10ClNO3Purity:95.0%Molecular weight:251.672-Chloro-5,8-dimethoxy-3-quinolinecarbaldehyde
CAS:2-Chloro-5,8-dimethoxy-3-quinolinecarbaldehyde is a functionalized allylation product that can be synthesized from anhydrous dmf and elemental analysis. It is an allylation agent that can be used in organic synthesis. 2-Chloro-5,8-dimethoxy-3-quinolinecarbaldehyde is best used as a reagent for the introduction of allylic groups to aromatic compounds. This compound has been shown to have a high yield and high purity.Formula:C12H10ClNO3Purity:Min. 95%Molecular weight:251.66 g/mol

