CAS 154357-43-4

5-Chloro-1-methyl-4-nitro-3-(trifluoromethyl)-1H-pyrazole

Description:

5-Chloro-1-methyl-4-nitro-3-(trifluoromethyl)-1H-pyrazole is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a chloro group, a methyl group, and a nitro group, as well as a trifluoromethyl group, contributing to its unique chemical properties. The presence of these functional groups influences its reactivity, solubility, and potential applications in various fields, including pharmaceuticals and agrochemicals. The trifluoromethyl group, in particular, is known to enhance lipophilicity and metabolic stability, making such compounds of interest in drug design. Additionally, the nitro group can participate in reduction reactions, while the chloro substituent may serve as a leaving group in nucleophilic substitution reactions. Overall, this compound's distinct structural features and functional groups make it a valuable subject of study in synthetic chemistry and material science.

Formula: C₅H₃ClF₃N₃O₂

InChI: InChI=1S/C5H3ClF3N3O2/c1-11-4(6)2(12(13)14)3(10-11)5(7,8)9/h1H3

InChI key: InChIKey=QXHBVZNPVARJAE-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C(C(F)(F)F)=NN(C)C1Cl

Synonyms:

• 1H-Pyrazole, 5-chloro-1-methyl-4-nitro-3-(trifluoromethyl)-
• 5-Chloro-3-trifluoromethyl-1-methyl-4-nitropyrazole
• 5-Chloro-1-methyl-4-nitro-3-(trifluoromethyl)-1H-pyrazole

5-Chloro-1-methyl-4-nitro-3-(trifluoromethyl)-1H-pyrazole

CAS: 154357-43-4

Versatile small molecule scaffold

Formula: C₅H₃ClF₃N₃O₂

Purity: Min. 95%

Molecular weight: 229.54 g/mol

Ref: 3D-EGA35743