CAS 154365-45-4

3,4-Dihydro-2-methyl-3-oxo-2H-pyrido[3,2-b]-1,4-oxazine-2-carboxylic acid

Description:

3,4-Dihydro-2-methyl-3-oxo-2H-pyrido[3,2-b]-1,4-oxazine-2-carboxylic acid is a heterocyclic compound characterized by its complex bicyclic structure, which includes a pyridine and an oxazine ring. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of a ketone group enhances its reactivity, making it a potential candidate for various chemical reactions, including condensation and substitution reactions. Its molecular structure suggests potential biological activity, which may be explored in pharmacological contexts. The compound is likely to exhibit moderate solubility in polar solvents due to the presence of both the carboxylic acid and ketone functionalities. Additionally, the methyl group on the pyridine ring may influence its steric and electronic properties, affecting its interactions with other molecules. Overall, this compound's unique structural features and functional groups make it of interest in both synthetic chemistry and medicinal chemistry research.

Formula: C₉H₈N₂O₄

InChI: InChI=1S/C9H8N2O4/c1-9(8(13)14)7(12)11-6-5(15-9)3-2-4-10-6/h2-4H,1H3,(H,13,14)(H,10,11,12)

InChI key: InChIKey=BQBSUGPNZXJKEH-UHFFFAOYSA-N

SMILES: C(O)(=O)C1(C)OC=2C(NC1=O)=NC=CC2

Synonyms:

• 2H-Pyrido[3,2-b]-1,4-oxazine-2-carboxylic acid, 3,4-dihydro-2-methyl-3-oxo-
• 3,4-Dihydro-2-methyl-3-oxo-2H-pyrido[3,2-b]-1,4-oxazine-2-carboxylic acid
• 2-Methyl-3-oxo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-2-carboxylic acid
• 2-Methyl-3-oxo-2H,3H,4H-pyrido[3,2-b][1,4]oxazine-2-carboxylic acid

3,4-Dihydro-2-methyl-3-oxo-2H-pyrido[3,2-b][1,4]oxazine-2-carboxylic acid

CAS: 154365-45-4

3,4-Dihydro-2-methyl-3-oxo-2H-pyrido[3,2-b][1,4]oxazine-2-carboxylic acid

Purity: 95%

Molecular weight: 208.17g/mol

Ref: 54-OR15231