CAS 154396-73-3
:RK-397
Description:
RK-397, with the CAS number 154396-73-3, is a chemical compound that has garnered interest in the field of medicinal chemistry, particularly for its potential therapeutic applications. It is characterized by its unique molecular structure, which contributes to its biological activity. RK-397 is known to interact with specific biological targets, making it a subject of research in drug development. The compound may exhibit properties such as selectivity for certain receptors or enzymes, which can influence its efficacy and safety profile. Additionally, RK-397's solubility, stability, and pharmacokinetic properties are crucial for its potential use in clinical settings. As with many compounds in this category, ongoing studies aim to elucidate its mechanism of action, optimize its formulation, and assess its therapeutic potential in various disease models. Overall, RK-397 represents a promising candidate in the exploration of new pharmacological agents.
Formula:C35H56O10
InChI:InChI=1/C35H56O10/c1-4-34-24(2)16-17-26(36)18-27(37)19-28(38)20-29(39)21-30(40)22-31(41)23-33(43)25(3)32(42)14-12-10-8-6-5-7-9-11-13-15-35(44)45-34/h5-13,15-17,24-34,36-43H,4,14,18-23H2,1-3H3
Synonyms:- 32-ethyl-14,16,18,20,22,24,26,28-octahydroxy-15,31-dimethyloxacyclodotriaconta-3,5,7,9,11,29-hexaen-2-one
- RK 397
- 14-Demethylmycoticin A
- Mycoticin A, 14-demethyl-
- RK 7
- RK-397 USP/EP/BP
- Oxacyclodotriacontane, mycoticin A deriv.
- 14-demethylmycoticina
- 14-demethyl-mycoticin
- Oxacyclodotriaconta-3,5,7,9,11,29-hexaen-2-one, 14,16,18,20,22,24,26,28-octahydroxy-31-methyl-32-(1-methylethyl)-, (3E,5E,7E,9E,11E,14S,16S,18S,20S,22R,24S,26R,28R,29E,31S,32S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
RK 397
CAS:<p>RK 397 is an antibiotic of oxopentaene macrolide.</p>Formula:C35H56O10Purity:98%Color and Shape:SolidMolecular weight:636.81RK-397
CAS:<p>Please enquire for more information about RK-397 including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C35H56O10Purity:Min. 95%Molecular weight:636.8 g/mol

