CAS 15444-20-9: Lysicamine

Description:Lysicamine, with the CAS number 15444-20-9, is a chemical compound that belongs to the class of alkaloids, specifically derived from the plant species of the genus Lycium. It is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Lysicamine has been studied for its potential pharmacological properties, including anti-inflammatory and neuroprotective effects. The compound exhibits solubility in organic solvents, which is typical for many alkaloids, and its stability can be influenced by environmental factors such as pH and temperature. In terms of safety, like many alkaloids, lysicamine may have toxicological implications, and its handling requires caution. Research into lysicamine is ongoing, focusing on its mechanisms of action and potential therapeutic applications, particularly in traditional medicine contexts. Overall, lysicamine represents a fascinating area of study within natural product chemistry and pharmacology.

Formula:C₁₈H₁₃NO₃

InChI:InChI=1S/C18H13NO3/c1-21-13-9-10-7-8-19-16-14(10)15(18(13)22-2)11-5-3-4-6-12(11)17(16)20/h3-9H,1-2H3

InChI key:InChIKey=DPBMWJXWUINLQT-UHFFFAOYSA-N

SMILES:O=C1C2=NC=CC3=CC(OC)=C(OC)C(C=4C=CC=CC14)=C32