CAS 154445-09-7

arohynapene B

Description:

Arohynapene B, with the CAS number 154445-09-7, is a naturally occurring chemical compound classified as a secondary metabolite. It is primarily derived from certain fungal species and is known for its unique structural features, which include a complex arrangement of carbon rings and functional groups. This compound exhibits notable biological activities, including potential antimicrobial and antifungal properties, making it of interest in pharmaceutical research. Arohynapene B's molecular structure contributes to its reactivity and interaction with biological systems, which can lead to various therapeutic applications. Additionally, its solubility and stability in different solvents can influence its extraction and purification processes. As research continues, further studies may elucidate its mechanisms of action and potential uses in medicine or agriculture. Overall, arohynapene B represents a fascinating area of study within natural product chemistry, highlighting the importance of secondary metabolites in drug discovery and development.

Formula: C₁₈H₂₂O₃

InChI: InChI=1/C18H22O3/c1-12-9-13(2)18-14(10-12)7-8-15(11-19)16(18)5-3-4-6-17(20)21/h3-8,12-13,19H,9-11H2,1-2H3,(H,20,21)/b5-3+,6-4+

Synonyms:

• 5-(2-Hydroxymethyl-6,8-dimethyl-5,6,7,8-tetrahydronaphthalene)-2,4-pentadienoic acid
• 2,4-Pentadienoic acid, 5-(5,6,7,8-tetrahydro-2-(hydroxymethyl)-6,8-dimethyl-1-naphthalenyl)-
• (2E,4E)-5-[2-(hydroxymethyl)-6,8-dimethyl-5,6,7,8-tetrahydronaphthalen-1-yl]penta-2,4-dienoic acid
• Arohynapene B

Arohynapene-B

CAS: 154445-09-7

Formula: C₁₈H₂₂O₃

Purity: 90.33%

Color and Shape: Yellowish. Solid

Molecular weight: 286.0

Ref: 8R-CL0280

Arohynapene-B

CAS: 154445-09-7

Please enquire for more information about Arohynapene-B including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₈H₂₂O₃

Purity: Min. 95%

Molecular weight: 286.40 g/mol

Ref: 3D-EGA44509

Arohynapene B

CAS: 154445-09-7

Arohynapene B is an anticoccidial compound that inhibits the growth of Eimeria parasites.

Formula: C₁₈H₂₂O₃

Color and Shape: Solid

Molecular weight: 286.366

Ref: TM-T205296