CAS 154476-57-0

1,3-bis(tert-butoxycarbonyl)guanidine

Description:

1,3-bis(tert-butoxycarbonyl)guanidine is a chemical compound characterized by its guanidine structure, which features two tert-butoxycarbonyl (Boc) protecting groups. This compound is typically used in organic synthesis, particularly in the preparation of various nitrogen-containing compounds and as an intermediate in the synthesis of pharmaceuticals. The presence of the Boc groups enhances the stability of the guanidine moiety and provides a means for selective deprotection under mild conditions, allowing for further functionalization. It is a white to off-white solid that is soluble in organic solvents, such as dichloromethane and dimethyl sulfoxide, but has limited solubility in water. The compound is generally handled with care due to its potential reactivity and should be stored in a cool, dry place away from incompatible substances. Its molecular structure contributes to its utility in synthetic chemistry, particularly in the development of complex molecules where guanidine functionalities are desired.

Formula: C₁₁H₂₁N₃O₄

InChI: InChI=1/C11H21N3O4/c1-10(2,3)17-8(15)13-7(12)14-9(16)18-11(4,5)6/h1-6H3,(H3,12,13,14,15,16)

SMILES: CC(C)(C)OC(=NC(=N)N=C(O)OC(C)(C)C)O

Synonyms:

• Tert-Butyl {Amino[(Tert-Butoxycarbonyl)Amino]Methylidene}Carbamate (Non-Preferred Name)
• N,N'-Bis(tert-butoxycarbonyl)guanidine

N,N'-Di-Boc-guanidine

CAS: 154476-57-0

Formula: C₁₁H₂₁N₃O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 259.3021

Ref: IN-DA003DI4

1,3-Bis(tert-butoxycarbonyl)guanidine

CAS: 154476-57-0

1,3-Bis(tert-butoxycarbonyl)guanidine

Purity: 99%

Molecular weight: 259.31g/mol

Ref: 54-OR74685

N,N'-Di-Boc-guanidine

CAS: 154476-57-0

Purity: 99.0%

Color and Shape: Solid, Crystalline Powder or Powder

Molecular weight: 259.3059997558594

Ref: 10-F242241