CAS 15448-77-8
:1-Methyl bicyclo[2.2.1]heptane-1,4-dicarboxylate
Description:
1-Methyl bicyclo[2.2.1]heptane-1,4-dicarboxylate is an organic compound characterized by its bicyclic structure, which consists of a bicyclo[2.2.1]heptane framework with a methyl group and two carboxylate ester groups. The presence of the dicarboxylate functional groups indicates that the compound can participate in various chemical reactions, such as esterification and hydrolysis. This compound is typically colorless to pale yellow in appearance and is soluble in organic solvents, making it useful in organic synthesis and as an intermediate in the production of other chemical compounds. Its unique bicyclic structure contributes to its stability and reactivity, allowing it to be utilized in the synthesis of more complex molecules. Additionally, the compound may exhibit interesting physical properties, such as boiling and melting points, which are influenced by its molecular structure and functional groups. Overall, 1-Methyl bicyclo[2.2.1]heptane-1,4-dicarboxylate is a versatile compound with potential applications in various fields of chemistry.
Formula:C10H14O4
InChI:InChI=1S/C10H14O4/c1-14-8(13)10-4-2-9(6-10,3-5-10)7(11)12/h2-6H2,1H3,(H,11,12)
InChI key:InChIKey=KVIKABYOBCHKNX-UHFFFAOYSA-N
SMILES:C(OC)(=O)C12CC(C(O)=O)(CC1)CC2
Synonyms:- Bicyclo[2.2.1]heptane-1,4-dicarboxylic acid, monomethyl ester
- 1,4-Norbornanedicarboxylic acid, monomethyl ester
- Bicyclo[2.2.1]heptane-1,4-dicarboxylic acid, 1-methyl ester
- 4-(Methoxycarbonyl)bicyclo[2.2.1]heptane-1-carboxylic acid
- 1-Methyl bicyclo[2.2.1]heptane-1,4-dicarboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Bicyclo[2.2.1]heptane-1,4-dicarboxylic acid, monomethyl ester
CAS:Formula:C10H14O4Purity:97%Color and Shape:SolidMolecular weight:198.2158Ref: IN-DA00389K
1g79.00€5g197.00€10g335.00€25g507.00€100gTo inquire250gTo inquire100mg30.00€250mg37.00€4-(Methoxycarbonyl)bicyclo[2.2.1]heptane-1-carboxylic acid
CAS:4-(Methoxycarbonyl)bicyclo[2.2.1]heptane-1-carboxylic acidPurity:97%Color and Shape:SolidMolecular weight:198.22g/mol4-(Methoxycarbonyl)bicyclo[2.2.1]heptane-1-carboxylic acid
CAS:Formula:C10H14O4Purity:95%Molecular weight:198.2184-(Methoxycarbonyl)bicyclo[2.2.1]heptane-1-carboxylic Acid
CAS:Controlled ProductFormula:C10H14O4Color and Shape:NeatMolecular weight:198.2164-(methoxycarbonyl)bicyclo[2.2.1]heptane-1-carboxylic acid
CAS:4-(Methoxycarbonyl)bicyclo[2.2.1]heptane-1-carboxylic acid is a dicarboxylic acid that can be prepared by the reaction of malonic ester and allyl alcohol in the presence of base. It is a precursor to 4-hydroxybutyric acid, which is an intermediate in the conversion of lysine to methionine. 4-(Methoxycarbonyl)bicyclo[2.2.1]heptane-1-carboxylic acid is used as a monoester and diester in the preparation of detergents and emulsifiers, as well as being used in the synthesis of pharmaceuticals and other organic compounds. The monoester form has been shown to have high yields for use with Burkholderia cepacia lipases (BCL) immobilized on silica gel, while the diesters are
Formula:C10H14O4Purity:Min. 95%Molecular weight:198.2 g/mol




