CAS 154505-91-6

1-(3,4-DIFLUOROPHENYL)-1H-PYRROLE-2,5-DIONE

Description:

1-(3,4-Difluorophenyl)-1H-pyrrole-2,5-dione, with the CAS number 154505-91-6, is a chemical compound characterized by its unique structure, which includes a pyrrole ring substituted with a 3,4-difluorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential reactivity due to the presence of the electron-withdrawing fluorine atoms. The pyrrole moiety contributes to its ability to participate in various chemical reactions, such as electrophilic substitutions. Additionally, the presence of the dione functional groups suggests that it may exhibit keto-enol tautomerism, influencing its stability and reactivity. This compound may also display interesting biological activities, making it a subject of interest in medicinal chemistry. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Overall, 1-(3,4-difluorophenyl)-1H-pyrrole-2,5-dione is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₁₀H₅F₂NO₂

InChI: InChI=1/C10H5F2NO2/c11-7-2-1-6(5-8(7)12)13-9(14)3-4-10(13)15/h1-5H

SMILES: c1cc(c(cc1N1C(=O)C=CC1=O)F)F

Synonyms:

• Akos Msc-0046
• N-(3,4-Difluorophenyl)Maleimide

N-(3,4-Difluorophenyl)maleimide

CAS: 154505-91-6

N-(3,4-Difluorophenyl)maleimide

Purity: ≥95%

Molecular weight: 209.15g/mol

Ref: 54-PC11118