CAS 154506-73-7: Fenoprofen calcium salt dihydrate

Description:Fenoprofen calcium salt dihydrate is a pharmaceutical compound primarily used as a non-steroidal anti-inflammatory drug (NSAID). It is the calcium salt form of fenoprofen, which is known for its analgesic and anti-inflammatory properties. This compound typically appears as a white to off-white crystalline powder and is soluble in water, making it suitable for various formulations. The dihydrate form indicates that it contains two molecules of water per formula unit, which can influence its stability and solubility characteristics. Fenoprofen calcium salt dihydrate is often utilized in the treatment of conditions such as arthritis and other inflammatory disorders, providing relief from pain and swelling. Its mechanism of action involves the inhibition of cyclooxygenase enzymes, leading to a decrease in the synthesis of prostaglandins, which are mediators of inflammation and pain. As with other NSAIDs, it may have side effects, including gastrointestinal discomfort and potential cardiovascular risks, necessitating careful consideration in clinical use.

Formula:C₁₅H₁₄O₃Ca·H₂O

InChI:InChI=1S/C15H14O3.Ca.H2O/c1-11(15(16)17)12-6-5-9-14(10-12)18-13-7-3-2-4-8-13;;/h2-11H,1H3,(H,16,17);;1H2

InChI key:InChIKey=TUWXDZBTJRWTMJ-UHFFFAOYSA-N

SMILES:[Ca].O=C(O)C(C=1C=CC=C(OC=2C=CC=CC2)C1)C.O