CymitQuimica logo

CAS 15451-07-7

:

3-(4-hydroxybenzyl)pentane-2,4-dione

Description:
3-(4-Hydroxybenzyl)pentane-2,4-dione, with the CAS number 15451-07-7, is an organic compound characterized by its diketone structure, featuring two carbonyl groups (C=O) located at the 2 and 4 positions of a pentane chain. The presence of a 4-hydroxybenzyl group at the 3-position contributes to its unique properties, including potential antioxidant activity due to the hydroxyl group. This compound is typically a yellow to orange solid and is soluble in organic solvents, reflecting its hydrophobic characteristics. It may exhibit tautomerism, where the keto and enol forms can interconvert, influencing its reactivity and stability. The compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Its reactivity can be attributed to the presence of both the diketone and the aromatic hydroxyl group, making it a versatile intermediate in organic synthesis.
Formula:C12H14O3
InChI:InChI=1/C12H14O3/c1-8(13)12(9(2)14)7-10-3-5-11(15)6-4-10/h3-6,12,15H,7H2,1-2H3
SMILES:CC(=O)C(Cc1ccc(cc1)O)C(=O)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.