CAS 154540-49-5

4-Amino-5-chloro-N-(1-((4-fluorophenyl)methyl)-4-piperidinyl)-2-methox ybenzamide

Description:

4-Amino-5-chloro-N-(1-((4-fluorophenyl)methyl)-4-piperidinyl)-2-methoxybenzamide, with CAS number 154540-49-5, is a chemical compound characterized by its complex structure, which includes an amino group, a chloro substituent, and a methoxy group on a benzamide backbone. This compound features a piperidine ring, which contributes to its pharmacological properties, and a fluorophenyl group that may enhance its lipophilicity and biological activity. It is typically classified as a pharmaceutical intermediate or a potential drug candidate, often investigated for its effects on various biological targets. The presence of multiple functional groups suggests that it may exhibit diverse interactions with biological systems, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other substances. As with many compounds of this nature, safety data and handling precautions are essential for laboratory work, given the potential for biological activity and toxicity.

Formula: C₂₀H₂₃ClFN₃O₂

InChI: InChI=1/C20H23ClFN3O2/c1-27-19-11-18(23)17(21)10-16(19)20(26)24-15-6-8-25(9-7-15)12-13-2-4-14(22)5-3-13/h2-5,10-11,15H,6-9,12,23H2,1H3,(H,24,26)

SMILES: COc1cc(c(cc1C(=NC1CCN(CC1)Cc1ccc(cc1)F)O)Cl)N

Synonyms:

• Fluoroclebopride
• 4-amino-5-chloro-N-[1-(4-fluorobenzyl)piperidin-4-yl]-2-methoxybenzamide

Benzamide,4-amino-5-chloro-N-[1-[(4-fluorophenyl)methyl]-4-piperidinyl]-2-methoxy-

CAS: 154540-49-5

Formula: C₂₀H₂₃ClFN₃O₂

Purity: 98%

Molecular weight: 391.8669

Ref: IN-DA007G2J

Fluoroclebopride

CAS: 154540-49-5

Fluoroclebopride

Purity: ≥98%

Molecular weight: 391.87g/mol

Ref: 54-BUP08193

Fluoroclebopride

CAS: 154540-49-5

Fluoroclebopride is a dopamine (DA) D2 receptor ligand.

Formula: C₂₀H₂₃ClFN₃O₂

Purity: 99.68% - 99.91%

Color and Shape: Solid

Molecular weight: 391.87

Ref: TM-T3187