CAS 154549-38-9
:2,4,6-Triisopropylbenzeneboronic acid
Description:
2,4,6-Triisopropylbenzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a triisopropyl-substituted benzene ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as dichloromethane and ethanol, while being less soluble in water due to its hydrophobic isopropyl groups. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and materials science. Its structure contributes to its unique reactivity, including the ability to form stable complexes with diols and other Lewis bases. Additionally, the steric bulk provided by the isopropyl groups can influence its reactivity and selectivity in chemical transformations. As with many organoboron compounds, it is important to handle this substance with care, as boronic acids can be sensitive to moisture and air, potentially affecting their stability and reactivity.
Formula:C15H25BO2
InChI:InChI=1/C15H25BO2/c1-9(2)12-7-13(10(3)4)15(16(17)18)14(8-12)11(5)6/h7-11,17-18H,1-6H3
SMILES:CC(C)c1cc(C(C)C)c(c(c1)C(C)C)B(O)O
Synonyms:- (2,4,6-Triisopropylphenyl)boronic acid
- boronic acid, B-[2,4,6-tris(1-methylethyl)phenyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,4,6-Triisopropylphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C15H25BO2Purity:min. 98.0 area%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:248.172,4,6-Triisopropylbenzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C15H25BO2Purity:98%Color and Shape:White, PowderMolecular weight:248.17(2,4,6-Triisopropylphenyl)boronic acid
CAS:Formula:C15H25BO2Purity:98%Color and Shape:SolidMolecular weight:248.16882,4,6-Triisopropylbenzeneboronic acid
CAS:2,4,6-Triisopropylbenzeneboronic acidPurity:98%Molecular weight:248.17g/mol(2,4,6-Triisopropylphenyl)boronic acid
CAS:Formula:C15H25BO2Purity:95%Color and Shape:Solid, Crystalline Powder or PowderMolecular weight:248.17




