CAS 15455-81-9
:Cholest-5-en-3-ol (3β)-, 3-(heptyl carbonate)
Description:
Cholest-5-en-3-ol (3β)-, 3-(heptyl carbonate), commonly referred to as a derivative of cholesterol, is a chemical compound characterized by its steroidal structure, which includes a hydroxyl group at the 3β position and a heptyl carbonate moiety. This compound is part of a larger class of sterols, which are known for their role in biological membranes and as precursors to various hormones. The presence of the heptyl carbonate group enhances its lipophilicity, potentially influencing its solubility and interaction with biological systems. The compound is typically studied for its potential applications in pharmaceuticals, particularly in drug delivery systems and as a surfactant due to its amphiphilic nature. Its CAS number, 15455-81-9, allows for precise identification in chemical databases. As with many sterols, it may exhibit specific biological activities, including effects on cell membrane fluidity and signaling pathways, making it of interest in both biochemistry and medicinal chemistry research.
Formula:C35H60O3
InChI:InChI=1S/C35H60O3/c1-7-8-9-10-11-23-37-33(36)38-28-19-21-34(5)27(24-28)15-16-29-31-18-17-30(26(4)14-12-13-25(2)3)35(31,6)22-20-32(29)34/h15,25-26,28-32H,7-14,16-24H2,1-6H3/t26-,28+,29+,30-,31+,32+,34+,35-/m1/s1
InChI key:InChIKey=VVEXXPUMMZEWSU-SJTWHRLHSA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@]([C@@H](CCCC(C)C)C)(CC4)[H])[H])(CC=C1C[C@@H](OC(OCCCCCCC)=O)CC2)[H])[H]
Synonyms:- 5-Cholesten-3β-ol heptyl carbonate
- Cholest-5-en-3-ol (3β)-, 3-(heptyl carbonate)
- Cholest-5-en-3-ol (3β)-, heptyl carbonate
- Cholest-5-en-3β-ol heptyl carbonate
- Cholesterol n-heptyl carbonate
- Cholesterol, heptyl carbonate
- Cholesteryl heptyl carbonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Cholesterol Heptyl Carbonate
CAS:Controlled ProductCholesterol heptyl carbonate is a cholesteric liquid crystal with a high melting point, which can be used as a coating for pharmaceutical tablets and other products. Cholesteric liquid crystals are composed of molecules that have different shapes in the solid phase and in the liquid phase, forming an ordered structure. The conformational state of the molecule determines the optical properties of cholesteric liquid crystals. This product has an average particle diameter of around 200 nm and is made from organic solvent. The treatment method for this product is not specified, but it may be treated by heating with thermal energy or using optical energy to create a cross-linked polymer network.Purity:Min. 95%

