CAS 154584-98-2
:2,4,5-TRIMETHOXYBENZYLAMINE
Description:
2,4,5-Trimethoxybenzylamine is an organic compound characterized by the presence of a benzene ring substituted with three methoxy groups and an amine functional group. The methoxy groups are located at the 2, 4, and 5 positions of the benzene ring, which significantly influences the compound's chemical properties and reactivity. This structure contributes to its potential as a ligand in coordination chemistry and its utility in organic synthesis. The amine group imparts basicity and can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the presence of multiple methoxy groups enhances the compound's solubility in organic solvents and may affect its biological activity. 2,4,5-Trimethoxybenzylamine may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. However, specific applications and biological effects would require further investigation and research. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C10H15NO3
InChI:InChI=1/C10H15NO3/c1-12-8-5-10(14-3)9(13-2)4-7(8)6-11/h4-5H,6,11H2,1-3H3
SMILES:COc1cc(c(cc1CN)OC)OC
Synonyms:- Rarechem Al Bw 0367
- Timtec-Bb Sbb010961
- Akos Bc-2646
- 1-(2,4,5-Trimethoxyphenyl)Methanamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,4,5-Trimethoxybenzylamine
CAS:2,4,5-Trimethoxybenzylamine is a synthetic compound that can be used as a precursor to the synthesis of other chemicals. It is prepared by reacting phenol with deuterium gas in a process called amination. This reaction is followed by reductive quaternization with cyanide. 2,4,5-Trimethoxybenzylamine is often used as an intermediate for the synthesis of drugs such as tamoxifen and clonidine.Formula:C10H15NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:197.23 g/mol


