CAS 15459-50-4

4-Chloro-2,6-diiodophenol

Description:

4-Chloro-2,6-diiodophenol is an organic compound characterized by its phenolic structure, which includes a chlorine atom and two iodine substituents on the aromatic ring. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of halogen atoms, particularly iodine, can influence its reactivity and biological activity, making it of interest in medicinal chemistry. It is generally soluble in organic solvents but may have limited solubility in water due to its hydrophobic nature. The compound's molecular structure contributes to its unique properties, such as its ability to participate in electrophilic substitution reactions. Additionally, 4-Chloro-2,6-diiodophenol may exhibit antimicrobial or antifungal activities, which can be explored in research and development. Safety data should be consulted for handling and usage, as halogenated compounds can pose health risks. Overall, this compound serves as a valuable subject for further investigation in chemical and biological research.

Formula: C₆H₃ClI₂O

InChI: InChI=1S/C6H3ClI2O/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H

InChI key: InChIKey=UCFDGPBRXPCSBW-UHFFFAOYSA-N

SMILES: OC1=C(I)C=C(Cl)C=C1I

Synonyms:

• Phenol, 4-chloro-2,6-diiodo-
• 4-Chloro-2,6-diiodophenol

4-Chloro-2,6-diiodophenol

CAS: 15459-50-4

Formula: C₆H₃ClI₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 380.3494

Ref: IN-DA00AX4S

4-Chloro-2,6-diiodophenol

CAS: 15459-50-4

4-Chloro-2,6-diiodophenol

Purity: 95%

Molecular weight: 380.35g/mol

Ref: 54-OR89849

4-Chloro-2,6-diiodophenol

CAS: 15459-50-4

Purity: 97%

Molecular weight: 380.3500061

Ref: 10-F616770

4-Chloro-2,6-diiodophenol

CAS: 15459-50-4

4-Chloro-2,6-diiodophenol is a disinfectant that belongs to the family of phenolic compounds. It is used as a water purifier and has been shown to be effective against Diptera, Culicidae and Trichoptera, although it is not effective against other insects. 4-Chloro-2,6-diiodophenol reacts with chlorine to form chloral hydrate, which is an intermediate in the synthesis of trichloroacetic acid. This reaction rate has been shown to increase with population density. The effectiveness of 4-chloro-2,6-diiodophenol as a disinfectant has been found to be dependent on the concentration of chlorine in the water.

Formula: C₆H₃ClI₂O

Purity: Min. 95%

Molecular weight: 380.35 g/mol

Ref: 3D-QAA45950