CAS 15463-91-9

b-Bromobenzenepropanoic acid

Description:

b-Bromobenzenepropanoic acid, with the CAS number 15463-91-9, is an organic compound characterized by the presence of a bromine atom and a carboxylic acid functional group attached to a propanoic acid chain. This compound features a bromobenzene moiety, where the bromine substituent is located on the benzene ring in the para position relative to the propanoic acid group. The presence of the bromine atom enhances the compound's reactivity, making it useful in various chemical synthesis applications, including the production of pharmaceuticals and agrochemicals. The carboxylic acid group contributes to its acidity and solubility in polar solvents, while the aromatic ring provides stability and unique electronic properties. Additionally, b-Bromobenzenepropanoic acid can participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the bromine atom. Overall, this compound serves as an important intermediate in organic synthesis and may exhibit biological activity, warranting further investigation into its potential applications.

Formula: C₉H₉BrO₂

InChI: InChI=1/C9H9BrO2/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,11,12)

SMILES: c1ccc(cc1)C(CC(=O)O)Br

Synonyms:

• b-Bromohydrocinnamic acid
• 3-Bromo-3-phenylpropionic Acid
• 3-Bromo-3-Phenylpropanoic Acid

β-Bromohydrocinnamic Acid

Controlled Product

CAS: 15463-91-9

Formula: C₉H₉BrO₂

Color and Shape: Neat

Molecular weight: 229.071

Ref: TR-B685195