CAS 154630-32-7

5-FLUORO-BENZO[B]THIOPHENE-2-CARBOXYLIC ACID METHYL ESTER

Description:

5-Fluoro-benzothiophene-2-carboxylic acid methyl ester is a chemical compound characterized by its unique structure, which includes a benzothiophene ring fused with a carboxylic acid moiety and a fluorine substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carboxylic acid and ester functional groups. The fluorine atom can influence the compound's electronic properties, potentially enhancing its lipophilicity and biological activity. As an ester, it may undergo hydrolysis under certain conditions, reverting to the corresponding carboxylic acid. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for more complex molecules. Its specific interactions and reactivity can be influenced by the presence of the fluorine atom and the overall molecular structure, making it a subject of study for researchers exploring novel chemical entities.

Formula: C₁₀H₇FO₂S

InChI: InChI=1/C10H7FO2S/c1-13-10(12)9-5-6-4-7(11)2-3-8(6)14-9/h2-5H,1H3

SMILES: COC(=O)c1cc2cc(ccc2s1)F

Synonyms:

• Methyl 5-Fluoro-1-Benzothiophene-2-Carboxylate

Methyl 5-fluorobenzo[b]thiophene-2-carboxylate

CAS: 154630-32-7

Methyl 5-fluorobenzo[b]thiophene-2-carboxylate

Purity: 95%

Molecular weight: 210.22g/mol

Ref: 54-PC8595

Methyl 5-fluorobenzo[b]thiophene-2-carboxylate

CAS: 154630-32-7

Formula: C₁₀H₇FO₂S

Purity: 96%

Color and Shape: Solid

Molecular weight: 210.22

Ref: 10-F240514