CymitQuimica logo

CAS 154634-96-5

:

(3S,5S)-3,5-dimethylmorpholine

Description:
(3S,5S)-3,5-dimethylmorpholine is a cyclic amine characterized by its morpholine structure, which consists of a six-membered ring containing both oxygen and nitrogen atoms. The specific stereochemistry indicated by the (3S,5S) configuration refers to the spatial arrangement of the methyl groups attached to the third and fifth carbon atoms of the morpholine ring, which influences its chemical properties and reactivity. This compound is typically a colorless to pale yellow liquid with a distinctive amine-like odor. It is soluble in water and organic solvents, making it versatile for various applications in organic synthesis and as a potential building block in pharmaceuticals and agrochemicals. The presence of the dimethyl groups contributes to its steric hindrance, which can affect its interaction with other molecules. Additionally, (3S,5S)-3,5-dimethylmorpholine may exhibit basic properties due to the nitrogen atom in the ring, allowing it to participate in protonation reactions. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H13NO
InChI:InChI=1/C6H13NO/c1-5-3-8-4-6(2)7-5/h5-7H,3-4H2,1-2H3/t5-,6-/m0/s1
InChI key:MDKHWJFKHDRFFZ-WDSKDSINSA-N
SMILES:C[C@H]1COC[C@H](C)N1
Synonyms:
  • Morpholine, 3,5-dimethyl-, (3S,5S)-
Found 4 products.