CAS 154675-18-0

2,2',3,3',4,4'-hexahydroxy-1,1'-biphenyl-6,6'-dimethanol dimethyl ether

Description:

2,2',3,3',4,4'-Hexahydroxy-1,1'-biphenyl-6,6'-dimethanol dimethyl ether, with CAS number 154675-18-0, is a complex organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features multiple hydroxyl (–OH) groups, contributing to its hydrophilicity and potential for forming hydrogen bonds, which can influence its solubility and reactivity. The presence of dimethyl ether groups suggests that it may exhibit ether-like properties, potentially affecting its volatility and interaction with other substances. Its multiple hydroxyl groups also indicate that it may serve as a polyol, making it useful in various applications, including as a building block in polymer chemistry or as an additive in formulations. The compound's structural complexity may lead to interesting physicochemical properties, such as varying melting and boiling points, depending on the specific arrangement of its functional groups. Overall, this substance may have applications in materials science, pharmaceuticals, or as a reagent in organic synthesis.

Formula: C₁₆H₁₈O₈

InChI: InChI=1/C16H18O8/c1-23-5-7-3-9(17)13(19)15(21)11(7)12-8(6-24-2)4-10(18)14(20)16(12)22/h3-4,17-22H,5-6H2,1-2H3

SMILES: COCc1cc(c(c(c1c1c(cc(c(c1O)O)O)COC)O)O)O

Synonyms:

• Hhbpdde
• 6,6'-Bis(Methoxymethyl)Biphenyl-2,2',3,3',4,4'-Hexol

HBDDE

CAS: 154675-18-0

HBDDE

Purity: ≥95%

Molecular weight: 338.31g/mol

Ref: 54-BUP07504

HBDDE

CAS: 154675-18-0

HBDDE inhibits PKCα/γ (IC50: 43/50 μM), favors them over PKCδ/βI/βII, and induces neuronal apoptosis. Derived from ellagic acid.

Formula: C₁₆H₁₈O₈

Purity: 99.99%

Color and Shape: Solid

Molecular weight: 338.31

Ref: TM-T39030