CymitQuimica logo

CAS 154709-18-9

:

[2'-(1-trityl-1H-tetrazol-5-yl)biphenyl-4-yl]methanol

Description:
The chemical substance known as [2'-(1-trityl-1H-tetrazol-5-yl)biphenyl-4-yl]methanol, with the CAS number 154709-18-9, is a complex organic compound characterized by its unique structural features. It contains a biphenyl moiety substituted with a tetrazole ring, which is further modified by a trityl group, enhancing its stability and solubility. The presence of the hydroxymethyl group indicates that it can participate in hydrogen bonding, making it potentially useful in various chemical reactions and applications. This compound may exhibit interesting biological activities due to the tetrazole ring, which is known for its pharmacological properties. Additionally, the trityl group can provide protection for reactive sites during synthetic processes. Overall, this substance is of interest in medicinal chemistry and materials science, where its unique properties can be exploited for the development of new drugs or functional materials. Its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods such as chromatography.
Formula:C33H26N4O
InChI:InChI=1/C33H26N4O/c38-24-25-20-22-26(23-21-25)30-18-10-11-19-31(30)32-34-35-36-37(32)33(27-12-4-1-5-13-27,28-14-6-2-7-15-28)29-16-8-3-9-17-29/h1-23,38H,24H2
SMILES:c1ccc(cc1)C(c1ccccc1)(c1ccccc1)n1c(c2ccccc2c2ccc(cc2)CO)nnn1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 6 products.