CymitQuimica logo

CAS 15473-32-2

:

N-Phenyldecanamide

Description:
N-Phenyldecanamide, with the CAS number 15473-32-2, is an organic compound characterized by its amide functional group and a long hydrocarbon chain. It features a phenyl group attached to a decanamide backbone, which contributes to its unique properties. This compound is typically a white to off-white solid at room temperature and is relatively insoluble in water due to its hydrophobic decyl chain, while it may exhibit solubility in organic solvents. N-Phenyldecanamide is known for its potential applications in various fields, including pharmaceuticals and materials science, owing to its ability to interact with biological systems and its structural characteristics. The presence of both hydrophobic and hydrophilic regions in its molecular structure allows it to participate in diverse chemical interactions. Additionally, it may exhibit properties such as melting and boiling points that are influenced by its molecular weight and structure. Overall, N-Phenyldecanamide is a compound of interest for further research and application in chemical synthesis and formulation.
Formula:C16H25NO
InChI:InChI=1S/C16H25NO/c1-2-3-4-5-6-7-11-14-16(18)17-15-12-9-8-10-13-15/h8-10,12-13H,2-7,11,14H2,1H3,(H,17,18)
InChI key:InChIKey=FGFCGFFGAXRCJG-UHFFFAOYSA-N
SMILES:N(C(CCCCCCCCC)=O)C1=CC=CC=C1
Synonyms:
  • Decananilide
  • Capric acid anilide
  • Decanamide, N-phenyl-
  • N-Phenyldecanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.