CAS 154775-43-6

1-BOC-PIPERIDIN-4-YLPROPIONIC ACID

Description:

1-BOC-PIPERIDIN-4-YLPROPIONIC ACID, with the CAS number 154775-43-6, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The "BOC" (tert-butyloxycarbonyl) group serves as a protective group for the amine functionality, enhancing the compound's stability and reactivity in various chemical reactions. This compound features a propionic acid moiety, contributing to its acidic properties. It is typically used in organic synthesis, particularly in the development of pharmaceuticals and biologically active compounds, due to its ability to serve as an intermediate in the formation of more complex structures. The presence of both the piperidine and propionic acid functionalities allows for diverse reactivity, making it a valuable building block in medicinal chemistry. Additionally, it is important to handle this compound with care, following appropriate safety protocols, as with many chemical substances, due to potential hazards associated with its use.

Formula: C₁₃H₂₂NO₄

InChI: InChI=1/C13H23NO4/c1-13(2,3)18-12(17)14-8-6-10(7-9-14)4-5-11(15)16/h10H,4-9H2,1-3H3,(H,15,16)/p-1

SMILES: CC(C)(C)OC(=O)N1CCC(CCC(=O)[O-])CC1

Synonyms:

• 3-[1-(Tert-Butoxycarbonyl)Piperidin-4-Yl]Propanoate

1-Boc-Piperidin-4-ylpropionic acid

CAS: 154775-43-6

Formula: C₁₃H₂₃NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 257.3260

Ref: IN-DA00APDB

3-(1-(tert-Butoxycarbonyl)piperidin-4-yl)propanoic acid

CAS: 154775-43-6

3-(1-(tert-Butoxycarbonyl)piperidin-4-yl)propanoic acid

Purity: 99%

Molecular weight: 257.33g/mol

Ref: 54-OR96860

1-Boc-Piperidin-4-ylpropionic acid

CAS: 154775-43-6

Formula: C₁₃H₂₃NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 257.33

Ref: 10-F011564