CAS 1548-74-9: 4-amino-2,3,5,6-tetrafluorobenzamide

Description:4-Amino-2,3,5,6-tetrafluorobenzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with four fluorine atoms and an amino group. The presence of multiple fluorine atoms contributes to its unique chemical properties, such as increased electronegativity and potential for strong hydrogen bonding due to the amino group. This compound is typically a solid at room temperature and may exhibit high thermal stability. Its fluorinated nature often imparts hydrophobic characteristics, making it less soluble in water compared to non-fluorinated analogs. The amino group can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Additionally, the compound may have applications in pharmaceuticals, agrochemicals, or materials science due to its specific reactivity and stability. Safety data should be consulted for handling, as fluorinated compounds can pose unique health and environmental risks.

Formula:C₇H₄F₄N₂O

InChI:InChI=1S/C7H4F4N2O/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H2,13,14)

InChI key:InChIKey=CAERPAFTLPIDJT-UHFFFAOYSA-N

SMILES:O=C(N)C1=C(F)C(F)=C(N)C(F)=C1F

Synonyms:
NSC 97005
4-Amino-2,3,5,6-tetrafluorobenzamide
Benzamide, 4-amino-2,3,5,6-tetrafluoro-

Found 5 products.

Product data	Purity	Price range	Estimated delivery
4-Amino-2,3,5,6-tetrafluorobenzamide REF: 3B-A0949CAS: 1548-74-9	>98.0%(GC)(N)	46.00 €~138.00 €	Mon 07 Apr 25
4-Amino-2,3,5,6-tetrafluorobenzamide REF: 10-F004020CAS: 1548-74-9	97.0%	34.00 €~262.00 €	Thu 10 Apr 25
4-Amino-2,3,5,6-tetrafluorobenzamide REF: IN-DA003KO0CAS: 1548-74-9	98%	To inquire	Mon 14 Apr 25
4-Amino-2,3,5,6-tetrafluorobenzamide REF: 54-PC1096CAS: 1548-74-9	97%	To inquire	Tue 15 Apr 25
4-Amino-2,3,5,6-Tetrafluorobenzamide REF: 3D-FA82736CAS: 1548-74-9	Min. 95%	- - -	Discontinued product