CAS 1548-81-8

2-Fluoro-6-bromobenzyl bromide

Description:

2-Fluoro-6-bromobenzyl bromide is an organic compound characterized by its aromatic structure, featuring a benzyl group substituted with both a fluorine and a bromine atom. The presence of these halogens significantly influences its reactivity and physical properties. This compound is typically a colorless to pale yellow liquid, exhibiting a relatively low boiling point and moderate solubility in organic solvents. Its molecular structure suggests that it may participate in nucleophilic substitution reactions, making it useful in various synthetic applications, particularly in the field of medicinal chemistry and material science. The fluorine atom can enhance the lipophilicity of the compound, while the bromine atom can serve as a leaving group in chemical reactions. Additionally, due to the presence of halogens, 2-Fluoro-6-bromobenzyl bromide may exhibit unique electronic properties, which can be exploited in the development of pharmaceuticals or agrochemicals. Safety precautions should be taken when handling this compound, as halogenated organic compounds can pose health and environmental risks.

Formula: C₇H₅Br₂F

InChI: InChI=1/C7H5Br2F/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2

SMILES: c1cc(c(CBr)c(c1)F)Br

Synonyms:

• 1-Bromo-2-(bromomethyl)-3-fluorobenzene
• Benzene, 1-Bromo-2-(Bromomethyl)-3-Fluoro-

1-Bromo-2-(bromomethyl)-3-fluorobenzene

CAS: 1548-81-8

Formula: C₇H₅Br₂F

Purity: 98%

Color and Shape: Solid

Molecular weight: 267.9210

Ref: IN-DA007FEN

2-Bromo-6-fluorobenzyl bromide

CAS: 1548-81-8

2-Bromo-6-fluorobenzyl bromide

Purity: ≥95%

Color and Shape: Liquid

Molecular weight: 267.92g/mol

Ref: 54-PC49622

2-Bromo-6-fluorobenzyl bromide

CAS: 1548-81-8

Formula: C₇H₅Br₂F

Purity: 95%

Color and Shape: Liquid

Molecular weight: 267.923

Ref: 10-F334168