CAS 154801-74-8
:(4R)-6-chloro-4-(cyclopropylethynyl)-4-(trifluoromethyl)-1,4-dihydro-2H-3,1-benzoxazin-2-one
Description:
(4R)-6-chloro-4-(cyclopropylethynyl)-4-(trifluoromethyl)-1,4-dihydro-2H-3,1-benzoxazin-2-one is a chemical compound characterized by its complex structure, which includes a benzoxazine core, a chloro substituent, and a trifluoromethyl group. The presence of the cyclopropylethynyl moiety contributes to its unique reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit specific solubility characteristics depending on the solvent used. Its trifluoromethyl group often enhances lipophilicity, which can influence biological activity and pharmacokinetics. The compound's stereochemistry, indicated by the (4R) configuration, suggests that it may exhibit chirality, potentially leading to different biological effects based on its enantiomeric forms. Additionally, the presence of chlorine and trifluoromethyl groups can impart significant electronic effects, making this compound of interest in the development of pharmaceuticals or agrochemicals. Overall, its unique structural features suggest potential utility in various chemical and biological applications.
Formula:C14H9ClF3NO2
InChI:InChI=1/C14H9ClF3NO2/c15-9-3-4-11-10(7-9)13(14(16,17)18,21-12(20)19-11)6-5-8-1-2-8/h3-4,7-8H,1-2H2,(H,19,20)/t13-/m1/s1
SMILES:C1CC1C#C[C@@]1(c2cc(ccc2N=C(O)O1)Cl)C(F)(F)F
Synonyms:- 2H-3,1-benzoxazin-2-one, 6-chloro-4-(2-cyclopropylethynyl)-1,4-dihydro-4-(trifluoromethyl)-, (4R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Efavirenz Enantiomer
CAS:Formula:C14H9ClF3NO2Color and Shape:White To Off-White SolidMolecular weight:315.68Efavirenz, (R)-
CAS:Efavirenz, (R)- is an antiviral agent and a nonnucleoside HIV-1 reverse transcriptase inhibitor.Formula:C14H9ClF3NO2Color and Shape:SolidMolecular weight:315.67
