CAS 15482-54-9
:(4-CARBOXYPHENYL)ACETONE
Description:
(4-Carboxyphenyl)acetone, with the CAS number 15482-54-9, is an organic compound characterized by the presence of both a carboxylic acid group and a ketone functional group. This compound features a phenyl ring substituted at the para position with a carboxylic acid group, while the acetone moiety contributes to its ketone functionality. The presence of these functional groups imparts unique chemical properties, including acidity due to the carboxylic acid and potential reactivity associated with the ketone. (4-Carboxyphenyl)acetone is typically a solid at room temperature and may exhibit solubility in polar solvents, depending on the specific conditions. Its structure allows for various applications in organic synthesis, potentially serving as an intermediate in the production of pharmaceuticals, agrochemicals, or other fine chemicals. Additionally, the compound may participate in various chemical reactions, such as esterification or condensation, making it a versatile building block in organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H10O3
InChI:InChI=1/C10H10O3/c1-7(11)6-8-2-4-9(5-3-8)10(12)13/h2-5H,6H2,1H3,(H,12,13)
SMILES:CC(=O)Cc1ccc(cc1)C(=O)O
Synonyms:- 4-(2-Oxopropyl)Benzoic Acid
- 2-Acetyl-4-Methylbenzoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(4-Carboxyphenyl)acetone
CAS:<p>Carboxyphenylacetone is a polymer drug that has been shown to have antimicrobial activity against P. aeruginosa, with the mechanism of action being the inhibition of DNA synthesis and protein synthesis. Carboxyphenylacetone also has anticancer properties, inhibiting human colon carcinoma cells by causing cell death and inhibiting proliferation. It has been shown to be an effective photoelectron scavenger and can be used for optical imaging studies. The conjugates are stable in acidic conditions and may be useful for treating infectious diseases such as HIV-1.</p>Formula:C10H10O3Purity:Min. 95%Color and Shape:PowderMolecular weight:178.18 g/mol
