CAS 15485-66-2

1-(2,4,6-Trihydroxyphenyl)-2-(4-methoxyphenyl)ethanone

Description:

1-(2,4,6-Trihydroxyphenyl)-2-(4-methoxyphenyl)ethanone, also known by its CAS number 15485-66-2, is an organic compound characterized by its complex structure featuring a ketone functional group and multiple hydroxyl groups. This compound is a derivative of phenolic compounds, which are known for their antioxidant properties. The presence of the tri-hydroxyphenyl group contributes to its potential biological activity, while the methoxy group enhances its solubility and stability. Typically, such compounds exhibit a range of chemical behaviors, including the ability to participate in hydrogen bonding due to the hydroxyl groups, which can influence their reactivity and interactions with other molecules. Additionally, the compound may display UV-Vis absorbance characteristics, making it useful in various applications, including pharmaceuticals and materials science. Its specific properties, such as melting point, solubility, and reactivity, would depend on the conditions under which it is studied, including solvent and temperature. Overall, this compound represents a significant interest in both synthetic and applied chemistry contexts.

Formula: C₁₅H₁₄O₅

InChI: InChI=1/C15H14O5/c1-20-11-4-2-9(3-5-11)6-12(17)15-13(18)7-10(16)8-14(15)19/h2-5,7-8,16,18-19H,6H2,1H3

SMILES: COc1ccc(cc1)CC(=O)c1c(cc(cc1O)O)O

Synonyms:

• 2-(4-Methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethan-1-one
• 2(4'-Methoxyphenyl)-2',4',6'-trihydroxyacetophenone
• 2-(4-Methoxyphenyl)-1-(2,4,6-Trihydroxyphenyl)Ethanone

1-(2,4,6-Trihydroxyphenyl)-2-(4-methoxyphenyl)ethanone

Controlled Product

CAS: 15485-66-2

Applications 1-(2,4,6-TRIHYDROXYPHENYL)-2-(4-METHOXYPHENYL)ETHANONE (cas# 15485-66-2) is a useful research chemical.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₁₅H₁₄O₅

Color and Shape: Neat

Molecular weight: 274.26

Ref: TR-T895800

2,4,6-Trihydroxy-4'-methoxydesoxybenzoin

CAS: 15485-66-2

2,4,6-Trihydroxy-4'-methoxydesoxybenzoin is a naturally occurring phenolic compound, which is derived from various plant sources, notably within the polyphenol class. This compound is characterized by its potential antioxidant properties, due to the presence of multiple hydroxyl groups, which contribute to its ability to neutralize free radicals and reduce oxidative stress.

Formula: C₁₅H₁₄O₅

Purity: Min. 95%

Molecular weight: 274.27 g/mol

Ref: 3D-XT161884