CAS 15486-33-6
:Kaempferol-7,4′-dimethyl ether
Description:
Kaempferol-7,4′-dimethyl ether is a flavonoid compound, specifically a derivative of kaempferol, which is known for its antioxidant properties. This substance features a flavone backbone with two methoxy groups at the 7 and 4' positions, enhancing its solubility and biological activity. It is typically found in various plants and has been studied for its potential health benefits, including anti-inflammatory, anticancer, and cardioprotective effects. The compound exhibits a yellow color and is soluble in organic solvents, making it useful in various applications, including food, cosmetics, and pharmaceuticals. Its structure contributes to its ability to scavenge free radicals, which is a key mechanism behind its protective effects in biological systems. Additionally, kaempferol derivatives are of interest in research for their potential role in preventing chronic diseases. As with many flavonoids, the bioavailability and metabolism of kaempferol-7,4′-dimethyl ether can vary, influencing its efficacy in therapeutic applications.
Formula:C17H14O6
InChI:InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)17-16(20)15(19)14-12(18)7-11(22-2)8-13(14)23-17/h3-8,18,20H,1-2H3
InChI key:InChIKey=KZBAXKKOXPLOBX-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC(=C1O)C3=CC=C(OC)C=C3)=CC(OC)=CC2O
Synonyms:- 3,5-Dihydroxy-4',7-dimethoxyflavone
- 3,5-Dihydroxy-4′,7-dimethoxyflavone
- 3,5-Dihydroxy-7,4′-dimethoxyflavone
- 3,5-Dihydroxy-7-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- 3,5-Dihydroxy-7-methoxy-2-(4-methoxyphenyl)chromen-4-one
- 3,5-dihydroxy-7-methoxy-2-(4-methoxyphenyl)-4H-chromen-4-one
- 4H-1-Benzopyran-4-one, 3,5-dihydroxy-7-methoxy-2-(4-methoxyphenyl)-
- 4′,7-Dimethoxykaempferol
- 4′,7-Dimethylkaempferol
- 7,4′-Di-O-methylkaempferol
- 7,4′-Dimethoxykaempferol
- 7,4′-Dimethylkaempferol
- Flavone, 3,5-dihydroxy-4′,7-dimethoxy-
- Kaempferol 4′,7-dimethyl ether
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3,5-DIHYDROXY-7-METHOXY-2-(4-METHOXY-PHENYL)-CHROMEN-4-ONE
CAS:Formula:C17H14O6Purity:98%Molecular weight:314.2895Kaempferol-7,4'-dimethyl ether
CAS:Kaempferol-7,4'-dimethyl etherPurity:≥98%Molecular weight:314.29g/molKaempferol-7,4'-dimethyl ether
CAS:Kaempferol-7,4'-dimethyl ether is isolated from the rhizomes of Zingiber phillipseae and exhibits antioxidant activity against S.Formula:C17H14O6Purity:98.06% - 98.90%Color and Shape:SolidMolecular weight:314.29Kaempferol 7,4'-dimethyl ether
CAS:Formula:C17H14O6Purity:95%~99%Color and Shape:Yellow powderMolecular weight:314.293Kaempferol-7,4'-dimethyl ether
CAS:Kaempferol-7,4'-dimethyl ether is a flavonoid derivative, which is a naturally occurring compound predominantly found in certain plant species. As a derivative of kaempferol, it is an O-methylated flavonoid, often isolated from various members of the Leguminosae family. Its mode of action involves interacting with multiple biological pathways, typically exhibiting antioxidant and anti-inflammatory properties. This potent flavonoid modulates signaling pathways and can influence cellular energy metabolism, often impacting reactive oxygen species (ROS) levels.Formula:C17H14O6Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:314.29 g/mol





