CAS 154885-33-3
:(R)-6-CHLORO-2-HEXANOL
Description:
(R)-6-Chloro-2-hexanol is an organic compound characterized by its chiral center, which imparts specific stereochemical properties to the molecule. As a secondary alcohol, it features a hydroxyl (-OH) group attached to the second carbon of a hexane chain, with a chlorine atom substituted at the sixth carbon. This substitution can influence the compound's reactivity and physical properties, such as boiling point and solubility. The presence of the chlorine atom typically enhances the compound's polarity, making it more soluble in polar solvents. Additionally, the chirality of (R)-6-chloro-2-hexanol can lead to different biological activities compared to its enantiomer, which is significant in pharmaceutical applications. The compound may be used in various chemical syntheses and as an intermediate in the production of other chemical entities. Its CAS number, 154885-33-3, allows for precise identification in chemical databases and regulatory contexts. Overall, (R)-6-chloro-2-hexanol is a valuable compound in organic chemistry with potential applications in medicinal chemistry and synthesis.
Formula:C6H13ClO
InChI:InChI=1/C6H13ClO/c1-6(8)4-2-3-5-7/h6,8H,2-5H2,1H3/t6-/m1/s1
Synonyms:- (2R)-6-chlorohexan-2-ol
- (R)-6-CHLORO-2-HEXANOL, 98+%
- (R)-6-CHLORO-2-HEXANOL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
