CAS 1549-88-8

trifluoperazine sulfoxide

Description:

Trifluoperazine sulfoxide, with the CAS number 1549-88-8, is a chemical compound derived from trifluoperazine, an antipsychotic medication. This sulfoxide derivative features a sulfur atom bonded to an oxygen atom, which contributes to its unique chemical properties. Trifluoperazine sulfoxide is characterized by its relatively high lipophilicity, allowing it to interact effectively with biological membranes. It exhibits pharmacological activity, primarily as an antipsychotic, and may influence neurotransmitter systems, particularly dopamine receptors. The compound is typically found in a solid state at room temperature and is soluble in organic solvents, which is common for sulfoxides. Its stability can be affected by environmental factors such as light and moisture. As with many sulfoxides, trifluoperazine sulfoxide may undergo oxidation or reduction reactions, making it a subject of interest in medicinal chemistry and drug development. Safety and handling precautions are essential due to its potential biological activity and the need for proper storage to maintain its integrity.

Formula: C₂₁H₂₄F₃N₃OS

InChI: InChI=1/C21H24F3N3OS/c1-25-11-13-26(14-12-25)9-4-10-27-17-5-2-3-6-19(17)29(28)20-8-7-16(15-18(20)27)21(22,23)24/h2-3,5-8,15H,4,9-14H2,1H3

SMILES: CN1CCN(CCCN2c3ccccc3S(=O)c3ccc(cc23)C(F)(F)F)CC1

Synonyms:

• 10H-Phenothiazine, 10-(3-(4-methyl-1-piperazinyl)propyl)-2-(trifluoromethyl)-, 5-oxide
• 10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)-10H-phenothiazine 5-oxide

Triphthazine Sulfoxide

CAS: 1549-88-8

Formula: C₂₁H₂₄F₃N₃OS

Molecular weight: 423.4950

Ref: IN-DA001NH1

Trifluoperazine Sulfoxide

CAS: 1549-88-8

Formula: C₂₁H₂₄F₃N₃OS

Molecular weight: 423.50

Ref: 4Z-T-716

Trifluoperazine Sulfoxide

Controlled Product

CAS: 1549-88-8

Formula: C₂₁H₂₄F₃N₃OS

Color and Shape: Neat

Molecular weight: 423.50

Ref: 86-MM0441.01

Triphthazine Sulfoxide

CAS: 1549-88-8

Applications Triphthazine Sulfoxide is used for the decomposition of sulfoxide metabolites of phenothiazine antipsychotics during gas chromatographic analysis.
References Hall, K., et al.:J Chromatogr. B. Biomed. Sci. Appl. 231, 200 (1982)

Formula: C₂₁H₂₄F₃N₃OS

Color and Shape: Neat

Molecular weight: 423.50

Ref: TR-T724820

Trifluoperazine Sulphoxide

CAS: 1549-88-8

Formula: C₂₁H₂₄F₃N₃OS

Molecular weight: 423.50

Ref: ST-EA-CP-T38003