CAS 154928-56-0
:1,2-Bis(4-hydroxyphenyl)-2-hydroxypropane
Description:
1,2-Bis(4-hydroxyphenyl)-2-hydroxypropane, commonly known as Bisphenol F (BPF), is an organic compound characterized by its structure, which features two hydroxyphenyl groups attached to a propane backbone. This compound is a type of bisphenol and is primarily used in the production of epoxy resins and polycarbonate plastics. BPF exhibits properties such as high thermal stability and resistance to chemical degradation, making it suitable for various industrial applications. It is also known for its potential endocrine-disrupting effects, similar to other bisphenols, raising concerns regarding its safety in consumer products. In terms of solubility, BPF is generally soluble in organic solvents but has limited solubility in water. Its molecular structure contributes to its ability to form strong intermolecular interactions, which is advantageous in polymer chemistry. Regulatory scrutiny has increased around bisphenols, including BPF, due to their environmental impact and potential health risks, prompting ongoing research into safer alternatives and the implications of their use in various applications.
Formula:C15H16O3
InChI:InChI=1S/C15H16O3/c1-15(18,12-4-8-14(17)9-5-12)10-11-2-6-13(16)7-3-11/h2-9,16-18H,10H2,1H3
InChI key:InChIKey=ODPHPWGPPAECAJ-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(O)C=C1)(C)(O)C2=CC=C(O)C=C2
Synonyms:- 1,2-Bis(4-hydroxyphenyl)-2-hydroxypropane
- Benzeneethanol, 4-hydroxy-α-(4-hydroxyphenyl)-α-methyl-
- 4-Hydroxy-α-(4-hydroxyphenyl)-α-methylbenzeneethanol
- 1,2-Bis(4-hydroxyphenyl)-2-propanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1,2-Bis(4-hydroxyphenyl)-2-hydroxypropane-d3
CAS:Controlled ProductApplications 1,2-Bis(4-hydroxyphenyl)-2-hydroxypropane-d3 is labelled 1,2-Bis(4-hydroxyphenyl)-2-hydroxypropane (B447367) which is a metabolite of bisphenol A (B519495). It works as an endocrine disruptor.
References Krishnan, A.V., et al.: Endocrinology, 132, 2279 (1993), Steinmetz, R., et al.: Trends Endocrinol. Metab., 9, 124 (1998); Kitamura, S., et al.: Toxicol. Sci., 84, 249 (2005)Formula:C15H13D3O3Color and Shape:NeatMolecular weight:243.7481,2-Bis(4-hydroxyphenyl)-2-hydroxypropane
CAS:Controlled ProductFormula:C15H16O3Color and Shape:NeatMolecular weight:257.775
