CAS 15496-39-6
:2-[(Methylamino)methyl]-α-phenylbenzenemethanol
Description:
2-[(Methylamino)methyl]-α-phenylbenzenemethanol, also known by its CAS number 15496-39-6, is an organic compound characterized by its complex structure, which includes a phenyl group, a benzyl alcohol moiety, and a methylamino functional group. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the presence of aromatic rings. The methylamino group introduces basic properties, allowing it to participate in various chemical reactions, including alkylation and acylation. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit biological activity. Additionally, the presence of both alcohol and amine functional groups may allow for hydrogen bonding, influencing its physical properties such as melting point and boiling point. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C15H17NO
InChI:InChI=1S/C15H17NO/c1-16-11-13-9-5-6-10-14(13)15(17)12-7-3-2-4-8-12/h2-10,15-17H,11H2,1H3
InChI key:InChIKey=OOJAOGKXAKBVSY-UHFFFAOYSA-N
SMILES:C(O)(C1=C(CNC)C=CC=C1)C2=CC=CC=C2
Synonyms:- 2-(Methylaminomethyl)benzhydrol
- Benzhydrol, 2-[(methylamino)methyl]-
- 2-[(Methylamino)methyl]-α-phenylbenzenemethanol
- [2-[(Methylamino)methyl]phenyl](phenyl)methanol
- Benzenemethanol, 2-[(methylamino)methyl]-α-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
